4-Carboxy-β-hydroxymethamphetamine-NBOH
4-(1-Hydroxy-2-{[(2-hydroxyphenyl)methyl](methyl)amino}propyl)benzoic acid
 9737  C18H21NO4  315.364
 InChI=1S/C18H21NO4/c1-12(19(2)11-15-5-3-4-6-16(15)20)17(21)13-7-9-14(10-8-13)18(22)23/h3-10,12,17,20-21H,11H2,1-2H3,(H,22,23)
 LEFDGVNUHQPTLF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C(C(c1ccc(cc1)C(=O)O)O)C)Cc1ccccc1O