4-(Hydroxymethyl)methamphetamine-NBOMe
[4-(2-{[(2-Methoxyphenyl)methyl](methyl)amino}propyl)phenyl]methanol
 9734  C19H25NO2  299.407
 InChI=1S/C19H25NO2/c1-15(12-16-8-10-17(14-21)11-9-16)20(2)13-18-6-4-5-7-19(18)22-3/h4-11,15,21H,12-14H2,1-3H3
 PYDZFSYZVLYVEJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccccc1CN(C(Cc1ccc(cc1)CO)C)C