4-Methylamphetamine-NBOH
2-({[1-(4-Methylphenyl)propan-2-yl]amino}methyl)phenol
 9731  C17H21NO  255.355
 InChI=1S/C17H21NO/c1-13-7-9-15(10-8-13)11-14(2)18-12-16-5-3-4-6-17(16)19/h3-10,14,18-19H,11-12H2,1-2H3
 DMEMFWAVBRZMGC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc(cc1)C)NCc1ccccc1O