3,4-DMA-NBOH
2-({[1-(3,4-Dimethoxyphenyl)propan-2-yl]amino}methyl)phenol
 9729 C18H23NO3 301.38
 InChI=1S/C18H23NO3/c1-13(19-12-15-6-4-5-7-16(15)20)10-14-8-9-17(21-2)18(11-14)22-3/h4-9,11,13,19-20H,10,12H2,1-3H3
 XEDRTLBYCASEPG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(ccc1OC)CC(NCc1ccccc1O)C