1-(2-{5-Chloro-2-[(2-methylprop-2-en-1-yl)oxy]phenyl}cyclopropyl)methanamine
 9684 C14H18ClNO 251.752
 InChI=1S/C14H18ClNO/c1-9(2)8-17-14-4-3-11(15)6-13(14)12-5-10(12)7-16/h3-4,6,10,12H,1,5,7-8,16H2,2H3
 QCDNVVKUZMADPW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC1CC1c1cc(Cl)ccc1OCC(=C)C