1-{2-[5-Chloro-2-(cyclopropylmethoxy)phenyl]cyclopropyl}methanamine
 9679 C14H18ClNO 251.752
 InChI=1S/C14H18ClNO/c15-11-3-4-14(17-8-9-1-2-9)13(6-11)12-5-10(12)7-16/h3-4,6,9-10,12H,1-2,5,7-8,16H2
 XVPNUHKQRMMHLY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC1CC1c1cc(Cl)ccc1OCC1CC1