1-[2-(5-Chloro-2,2-dimethyl-2,3-dihydro-1-benzofuran-7-yl)cyclopropyl]methanamine
 9675 C14H18ClNO 251.752
 InChI=1S/C14H18ClNO/c1-14(2)6-8-3-10(15)5-12(13(8)17-14)11-4-9(11)7-16/h3,5,9,11H,4,6-7,16H2,1-2H3
 ALNNHFGNPITCHG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC1CC1c1cc(Cl)cc2c1OC(C2)(C)C