1-[2-(5-Methoxy-1-benzofuran-4-yl)cyclopropyl]methanamine
 9650 C13H15NO2 217.264
 InChI=1S/C13H15NO2/c1-15-12-3-2-11-9(4-5-16-11)13(12)10-6-8(10)7-14/h2-5,8,10H,6-7,14H2,1H3
 NMQSOAPOAUZPPJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC1CC1c1c(OC)ccc2c1cco2