1-{2-[5-(2-Fluoroethoxy)-2,3-dihydro-1-benzofuran-4-yl]cyclopropyl}methanamine
 9649 C14H18FNO2 251.297
 InChI=1S/C14H18FNO2/c15-4-6-18-13-2-1-12-10(3-5-17-12)14(13)11-7-9(11)8-16/h1-2,9,11H,3-8,16H2
 ICLMFPQBAAMUKM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 FCCOc1ccc2c(c1C1CC1CN)CCO2