1-[2-(5-Propoxy-2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methanamine
 9646 C15H21NO2 247.333
 InChI=1S/C15H21NO2/c1-2-6-17-14-4-3-13-11(5-7-18-13)15(14)12-8-10(12)9-16/h3-4,10,12H,2,5-9,16H2,1H3
 ZXYYNJYQQDXPDT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCOc1ccc2c(c1C1CC1CN)CCO2