1-[2-(5-Ethoxy-2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methanamine
 9645 C14H19NO2 233.306
 InChI=1S/C14H19NO2/c1-2-16-13-4-3-12-10(5-6-17-12)14(13)11-7-9(11)8-15/h3-4,9,11H,2,5-8,15H2,1H3
 ZFGDZQUAQZGADF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1ccc2c(c1C1CC1CN)CCO2