4-(2-{[(2-Methoxyphenyl)methyl]amino}propyl)benzoic acid
 9609  C18H21NO3  299.364
 InChI=1S/C18H21NO3/c1-13(11-14-7-9-15(10-8-14)18(20)21)19-12-16-5-3-4-6-17(16)22-2/h3-10,13,19H,11-12H2,1-2H3,(H,20,21)
 GGXOADHAGKMSTK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccccc1CNC(Cc1ccc(cc1)C(=O)O)C