4-(2-{[(2-Methoxyphenyl)methyl]amino}propyl)benzene-1,2-diol
 9607 C17H21NO3 287.354
 InChI=1S/C17H21NO3/c1-12(9-13-7-8-15(19)16(20)10-13)18-11-14-5-3-4-6-17(14)21-2/h3-8,10,12,18-20H,9,11H2,1-2H3
 WSHFGUWTHCUPBP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccccc1CNC(Cc1ccc(c(c1)O)O)C