2,5-DMA-NPI
N-[1-(2,5-Dimethoxyphenyl)propan-2-yl]propan-2-imine
 9581 C14H21NO2 235.322
 InChI=1S/C14H21NO2/c1-10(2)15-11(3)8-12-9-13(16-4)6-7-14(12)17-5/h6-7,9,11H,8H2,1-5H3
 PPJWWWIUPIMCRP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(cc1CC(N=C(C)C)C)OC