PCMPA
N-(3-Methoxypropyl)-1-phenylcyclohexan-1-amine
 956 C16H25NO 247.376
 Arylcycloalkylamine
 InChI=1S/C16H25NO/c1-18-14-8-13-17-16(11-6-3-7-12-16)15-9-4-2-5-10-15/h2,4-5,9-10,17H,3,6-8,11-14H2,1H3
 OWOACIUDSBGLMN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COCCCNC1(CCCCC1)c1ccccc1