PCMEA
N-(2-Methoxyethyl)-1-phenylcyclohexan-1-amine
 954 C15H23NO 233.349
 Arylcycloalkylamine
 InChI=1S/C15H23NO/c1-17-13-12-16-15(10-6-3-7-11-15)14-8-4-2-5-9-14/h2,4-5,8-9,16H,3,6-7,10-13H2,1H3
 MSZKHYPXVOHFEV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COCCNC1(CCCCC1)c1ccccc1