2-Ph-AMT
1-(2-Phenyl-1H-indol-3-yl)propan-2-amine
 9391  C17H18N2  250.338
 InChI=1S/C17H18N2/c1-12(18)11-15-14-9-5-6-10-16(14)19-17(15)13-7-3-2-4-8-13/h2-10,12,19H,11,18H2,1H3
 GOPCDZFAFBMJGR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1c([nH]c2c1cccc2)c1ccccc1)N