2,3,6-Trimethoxy-β-nitrostyrene
1,2,4-Trimethoxy-3-[(E)-2-nitroethenyl]benzene
 9388  C11H13NO5  239.225
 InChI=1S/C11H13NO5/c1-15-9-4-5-10(16-2)11(17-3)8(9)6-7-12(13)14/h4-7H,1-3H3/b7-6+
 IMGIPZDSMOTNBB-VOTSOKGWSA-N This stereoisomer Any stereoisomer
 COc1ccc(c(c1/C=C/N(=O)=O)OC)OC