2-Ethoxy-4,6-dimethyl-β-nitrostyrene
1-Ethoxy-3,5-dimethyl-2-[(E)-2-nitroethenyl]benzene
 9384  C12H15NO3  221.252
 InChI=1S/C12H15NO3/c1-4-16-12-8-9(2)7-10(3)11(12)5-6-13(14)15/h5-8H,4H2,1-3H3/b6-5+
 SBIRXUKKPUONKR-AATRIKPKSA-N This stereoisomer Any stereoisomer
 CCOc1cc(C)cc(c1/C=C/N(=O)=O)C