2-Methoxy-4,6-dimethyl-β-nitrostyrene
1-Methoxy-3,5-dimethyl-2-[(E)-2-nitroethenyl]benzene
 9383  C11H13NO3  207.226
 InChI=1S/C11H13NO3/c1-8-6-9(2)10(4-5-12(13)14)11(7-8)15-3/h4-7H,1-3H3/b5-4+
 UBPMTJPZEFVOJU-SNAWJCMRSA-N This stereoisomer Any stereoisomer
 COc1cc(C)cc(c1/C=C/N(=O)=O)C