4-Methoxy-2,6-dimethyl-β-nitrostyrene
5-Methoxy-1,3-dimethyl-2-[(E)-2-nitroethenyl]benzene
 9381  C11H13NO3  207.226
 InChI=1S/C11H13NO3/c1-8-6-10(15-3)7-9(2)11(8)4-5-12(13)14/h4-7H,1-3H3/b5-4+
 KCLAPPJDHCXORZ-SNAWJCMRSA-N This stereoisomer Any stereoisomer
 COc1cc(C)c(c(c1)C)/C=C/N(=O)=O