3-(2,5-Dimethoxyphenyl)piperidine
 937 C13H19NO2 221.295
 InChI=1S/C13H19NO2/c1-15-11-5-6-13(16-2)12(8-11)10-4-3-7-14-9-10/h5-6,8,10,14H,3-4,7,9H2,1-2H3
 MPOSBTBOIRHAEE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(cc1C1CCCNC1)OC