(sec-Butyl) 5F-2-ADB-PINACA
N-(1-Amino-3-methyl-1-oxopentan-2-yl)-2-(5-fluoropentyl)-2H-indazole-3-carboxamide
 9302 C19H27FN4O2 362.442
 InChI=1S/C19H27FN4O2/c1-3-13(2)16(18(21)25)22-19(26)17-14-9-5-6-10-15(14)23-24(17)12-8-4-7-11-20/h5-6,9-10,13,16H,3-4,7-8,11-12H2,1-2H3,(H2,21,25)(H,22,26)
 CIXZTODJNNGQFI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 FCCCCCn1nc2c(c1C(=O)NC(C(CC)C)C(=O)N)cccc2