Pseudoephedrine-BOC
tert-Butyl (1-hydroxy-1-phenylpropan-2-yl)methylcarbamate
 9299  C15H23NO3  265.348
 InChI=1S/C15H23NO3/c1-11(13(17)12-9-7-6-8-10-12)16(5)14(18)19-15(2,3)4/h6-11,13,17H,1-5H3
 SIKODEFLCMOILM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(C(c1ccccc1)O)N(C(=O)OC(C)(C)C)C