N-Propanoyl-MDMA
N-[1-(2H-1,3-Benzodioxol-5-yl)propan-2-yl]-N-methylpropanamide
 9051  C14H19NO3  249.306
 InChI=1S/C14H19NO3/c1-4-14(16)15(3)10(2)7-11-5-6-12-13(8-11)18-9-17-12/h5-6,8,10H,4,7,9H2,1-3H3
 RDZWUIDIHZUONQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(=O)N(C(Cc1ccc2c(c1)OCO2)C)C