M-CHMIC
1-(Cyclohexylmethyl)-2-methyl-1H-indole-3-carboxylic acid
 8681  C17H21NO2  271.354
 Cannabinoid
 InChI=1S/C17H21NO2/c1-12-16(17(19)20)14-9-5-6-10-15(14)18(12)11-13-7-3-2-4-8-13/h5-6,9-10,13H,2-4,7-8,11H2,1H3,(H,19,20)
 SVSIIIWUZHSNQQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 OC(=O)c1c(C)n(c2c1cccc2)CC1CCCCC1