α-Hydroxy-α-PPP
1-Phenyl-2-(pyrrolidin-1-yl)propan-1-ol
 8666 C13H19NO 205.296
 InChI=1S/C13H19NO/c1-11(14-9-5-6-10-14)13(15)12-7-3-2-4-8-12/h2-4,7-8,11,13,15H,5-6,9-10H2,1H3
 FZVHJGJBJLFWEX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 OC(C(N1CCCC1)C)c1ccccc1