BM-MDPV
1-[2-(2H-1,3-Benzodioxol-5-yl)hexan-3-yl]pyrrolidine
 8662 C17H25NO2 275.386
 InChI=1S/C17H25NO2/c1-3-6-15(18-9-4-5-10-18)13(2)14-7-8-16-17(11-14)20-12-19-16/h7-8,11,13,15H,3-6,9-10,12H2,1-2H3
 FFEJXPQBYXRFGA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCC(C(c1ccc2c(c1)OCO2)C)N1CCCC1