BM-4-FA
3-(4-Fluorophenyl)butan-2-amine
 8661  C10H14FN  167.223
 InChI=1S/C10H14FN/c1-7(8(2)12)9-3-5-10(11)6-4-9/h3-8H,12H2,1-2H3
 CIPINOPHNGWDEZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(c1ccc(cc1)F)C(N)C