BM-4-MA
3-(4-Methylphenyl)butan-2-amine
 8659 C11H17N 163.259
 InChI=1S/C11H17N/c1-8-4-6-11(7-5-8)9(2)10(3)12/h4-7,9-10H,12H2,1-3H3
 SQFFSZMDAYVKMK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(C(c1ccc(cc1)C)C)N