3-Methylmethylphenidate
Methyl (3-methylphenyl)(piperidin-2-yl)acetate
 8644 C15H21NO2 247.333
 InChI=1S/C15H21NO2/c1-11-6-5-7-12(10-11)14(15(17)18-2)13-8-3-4-9-16-13/h5-7,10,13-14,16H,3-4,8-9H2,1-2H3
 NRBMYZAWNJOHPY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COC(=O)C(c1cccc(c1)C)C1CCCCN1