Butylphenidate
Butyl phenyl(piperidin-2-yl)acetate
 8638 C17H25NO2 275.386
 InChI=1S/C17H25NO2/c1-2-3-13-20-17(19)16(14-9-5-4-6-10-14)15-11-7-8-12-18-15/h4-6,9-10,15-16,18H,2-3,7-8,11-13H2,1H3
 BMITZBVIXKTTQB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCOC(=O)C(c1ccccc1)C1CCCCN1