MDNSB
1-[1-(2H-1,3-Benzodioxol-5-yl)cyclobutyl]-N,3-dimethylbutan-1-amine
 8626 C17H25NO2 275.386
 InChI=1S/C17H25NO2/c1-12(2)9-16(18-3)17(7-4-8-17)13-5-6-14-15(10-13)20-11-19-14/h5-6,10,12,16,18H,4,7-9,11H2,1-3H3
 IFWGKZCAMPDMKG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C1(CCC1)c1ccc2c(c1)OCO2)CC(C)C