TH-PVP
2-(Pyrrolidin-1-yl)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)pentan-1-one
 8622 C19H27NO 285.424
 InChI=1S/C19H27NO/c1-2-7-18(20-12-5-6-13-20)19(21)17-11-10-15-8-3-4-9-16(15)14-17/h10-11,14,18H,2-9,12-13H2,1H3
 MMIKQWIZKBYLKZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCC(C(=O)c1ccc2c(c1)CCCC2)N1CCCC1