2-Me-PPP
1-(2-Methylphenyl)-2-(pyrrolidin-1-yl)propan-1-one
 8602 C14H19NO 217.307
 InChI=1S/C14H19NO/c1-11-7-3-4-8-13(11)14(16)12(2)15-9-5-6-10-15/h3-4,7-8,12H,5-6,9-10H2,1-2H3
 ITKKRQLIQITCHA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(C(=O)c1ccccc1C)N1CCCC1