bk-UWA-101
1-(2H-1,3-Benzodioxol-5-yl)-2-cyclopropyl-2-(methylamino)ethan-1-one
 8586  C13H15NO3  233.263
 InChI=1S/C13H15NO3/c1-14-12(8-2-3-8)13(15)9-4-5-10-11(6-9)17-7-16-10/h4-6,8,12,14H,2-3,7H2,1H3
 JXBKYKRFZMSQJZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C(=O)c1ccc2c(c1)OCO2)C1CC1