DL-4662
1-(3,4-Dimethoxyphenyl)-2-(ethylamino)pentan-1-one
 8579  C15H23NO3  265.348
 InChI=1S/C15H23NO3/c1-5-7-12(16-6-2)15(17)11-8-9-13(18-3)14(10-11)19-4/h8-10,12,16H,5-7H2,1-4H3
 WZVCLFAACAERMB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCC(C(=O)c1ccc(c(c1)OC)OC)NCC