bk-DMMDA
2-Amino-1-(4,7-dimethoxy-2H-1,3-benzodioxol-5-yl)propan-1-one
 8575  C12H15NO5  253.251
 InChI=1S/C12H15NO5/c1-6(13)9(14)7-4-8(15-2)11-12(10(7)16-3)18-5-17-11/h4,6H,5,13H2,1-3H3
 LXVDOTXYHAVCSZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C(=O)C(N)C)c(c2c1OCO2)OC