4-MeO-NEB
2-(Ethylamino)-1-(4-methoxyphenyl)butan-1-one
 8574 C13H19NO2 221.295
 InChI=1S/C13H19NO2/c1-4-12(14-5-2)13(15)10-6-8-11(16-3)9-7-10/h6-9,12,14H,4-5H2,1-3H3
 SZBBAOZTUVSHKF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC(C(=O)c1ccc(cc1)OC)CC