4-Me-DMB
2-(Dimethylamino)-1-(4-methylphenyl)butan-1-one
 8570  C13H19NO  205.296
 InChI=1S/C13H19NO/c1-5-12(14(3)4)13(15)11-8-6-10(2)7-9-11/h6-9,12H,5H2,1-4H3
 UKVFBTRCNFUOFU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(C(=O)c1ccc(cc1)C)N(C)C