EDMC
1-(2,3-Dihydro-1,4-benzodioxin-6-yl)-2-(methylamino)propan-1-one
 8567  C12H15NO3  221.252
 InChI=1S/C12H15NO3/c1-8(13-2)12(14)9-3-4-10-11(7-9)16-6-5-15-10/h3-4,7-8,13H,5-6H2,1-2H3
 MRFMNGZRIIBJTB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C(=O)c1ccc2c(c1)OCCO2)C