2,3-MDMC
1-(2H-1,3-Benzodioxol-4-yl)-2-(methylamino)propan-1-one
 8563  C11H13NO3  207.226
 InChI=1S/C11H13NO3/c1-7(12-2)10(13)8-4-3-5-9-11(8)15-6-14-9/h3-5,7,12H,6H2,1-2H3
 QZMXFYXIDZEAQA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(C(=O)c1cccc2c1OCO2)NC