bk-MDOM
1-(2,5-Dimethoxy-4-methylphenyl)-2-(methylamino)propan-1-one
 8559 C13H19NO3 237.295
 InChI=1S/C13H19NO3/c1-8-6-12(17-5)10(7-11(8)16-4)13(15)9(2)14-3/h6-7,9,14H,1-5H3
 HEXBGPNMFXCUIL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C(=O)c1cc(OC)c(cc1OC)C)C