bk-2C-iP
2-Amino-1-[2,5-dimethoxy-4-(propan-2-yl)phenyl]ethan-1-one
 8556 C13H19NO3 237.295
 InChI=1S/C13H19NO3/c1-8(2)9-5-13(17-4)10(11(15)7-14)6-12(9)16-3/h5-6,8H,7,14H2,1-4H3
 ZOPYJOSHJWJRDS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C(=O)CN)c(cc1C(C)C)OC