bk-2C-P
2-Amino-1-(2,5-dimethoxy-4-propylphenyl)ethan-1-one
 8555 C13H19NO3 237.295
 InChI=1S/C13H19NO3/c1-4-5-9-6-13(17-3)10(11(15)8-14)7-12(9)16-2/h6-7H,4-5,8,14H2,1-3H3
 KZAHSUUNIGIPKD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCc1cc(OC)c(cc1OC)C(=O)CN