3F-Buphedrone
1-(3-Fluorophenyl)-2-(methylamino)butan-1-one
 8532  C11H14FNO  195.233
 InChI=1S/C11H14FNO/c1-3-10(13-2)11(14)8-5-4-6-9(12)7-8/h4-7,10,13H,3H2,1-2H3
 DEPKXUSHIOLSRD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(C(=O)c1cccc(c1)F)NC