POMMC
1-(3-Methoxy-4-propoxyphenyl)-2-(methylamino)propan-1-one
 8524 C14H21NO3 251.321
 InChI=1S/C14H21NO3/c1-5-8-18-12-7-6-11(9-13(12)17-4)14(16)10(2)15-3/h6-7,9-10,15H,5,8H2,1-4H3
 KQAQIZJLHCKKQH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCOc1ccc(cc1OC)C(=O)C(NC)C