3,4-DMOMC
1-(3,4-Dimethoxyphenyl)-2-(methylamino)propan-1-one
 8523  C12H17NO3  223.268
 InChI=1S/C12H17NO3/c1-8(13-2)12(14)9-5-6-10(15-3)11(7-9)16-4/h5-8,13H,1-4H3
 VFOPXGBJCFJIFX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C(=O)c1ccc(c(c1)OC)OC)C