2,4,5-TMOMC
2-(Methylamino)-1-(2,4,5-trimethoxyphenyl)propan-1-one
 8518 C13H19NO4 253.294
 InChI=1S/C13H19NO4/c1-8(14-2)13(15)9-6-11(17-4)12(18-5)7-10(9)16-3/h6-8,14H,1-5H3
 FQNXDKDELUJOHB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C(=O)c1cc(OC)c(cc1OC)OC)C