2,4-DMEC
1-(2,4-Dimethylphenyl)-2-(ethylamino)propan-1-one
 8515  C13H19NO  205.296
 InChI=1S/C13H19NO/c1-5-14-11(4)13(15)12-7-6-9(2)8-10(12)3/h6-8,11,14H,5H2,1-4H3
 SJPGBKUKQFPPPH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC(C(=O)c1ccc(cc1C)C)C